About 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine
2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine (PubChem CID 68623177) has the molecular formula C20H14N4O
and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine |
| PubChem CID | 68623177 |
| Molecular Formula | C20H14N4O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine |
| SMILES | Cc1occc1-c1cc(-c2c[nH]c3cnccc23)c2cccnc2n1 |
| InChI | InChI=1S/C20H14N4O/c1-12-13(5-8-25-12)18-9-16(15-3-2-6-22-20(15)24-18)17-10-23-19-11-21-7-4-14(17)19/h2-11,23H,1H3 |
| InChIKey | DPBAIDJJBOXBPR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine?
The IUPAC name of 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine (CID 68623177) is 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine.
What is the SMILES notation for 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine?
The canonical SMILES for 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine is Cc1occc1-c1cc(-c2c[nH]c3cnccc23)c2cccnc2n1.
What is the InChIKey of 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine?
The InChIKey is DPBAIDJJBOXBPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O/c1-12-13(5-8-25-12)18-9-16(15-3-2-6-22-20(15)24-18)17-10-23-19-11-21-7-4-14(17)19/h2-11,23H,1H3.
What are the key properties of 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine?
2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine has a molecular weight of 326.36 g/mol, XLogP of 4.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylfuran-3-yl)-4-(1H-pyrrolo[2,3-c]pyridin-3-yl)-1,8-naphthyridine is sourced from PubChem (CID 68623177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).