C23H42N4O10 — CID 68623201
butyl (2S)-2-acetyl-5-amino-2-[2-[(2S,3R,4R,5S,6R)-3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropyl-[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate (PubChem CID 68623201) has the molecular formula C23H42N4O10 and a molecular weight of 534.61 g/mol. Its IUPAC name is butyl (2S)-2-acetyl-5-amino-2-[2-[(2S,3R,4R,5S,6R)-3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropyl-[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate.
| Compound Name | butyl (2S)-2-acetyl-5-amino-2-[2-[(2S,3R,4R,5S,6R)-3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropyl-[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 68623201 |
| Molecular Formula | C23H42N4O10 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | butyl (2S)-2-acetyl-5-amino-2-[2-[(2S,3R,4R,5S,6R)-3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropyl-[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate |
| SMILES | CCCCOC(=O)[C@](CCC(N)=O)(C(C)=O)N(CC(C)O[C@@H]1[C@@H](N)[C@@H](O)O[C@H](CO)[C@H]1O)C(=O)[C@H](C)N |
| InChI | InChI=1S/C23H42N4O10/c1-5-6-9-35-22(34)23(14(4)29,8-7-16(25)30)27(20(32)13(3)24)10-12(2)36-19-17(26)21(33)37-15(11-28)18(19)31/h12-13,15,17-19,21,28,31,33H,5-11,24,26H2,1-4H3,(H2,25,30)/t12?,13-,15+,17+,18+,19+,21-,23-/m0/s1 |
| InChIKey | TXERNNQDTWWMNV-QNJJMIOBSA-N |
| XLogP | -2.73 |
| TPSA | 237.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|