About Isonicotinic acid, cinnamylidenehydrazide
Isonicotinic acid, cinnamylidenehydrazide (PubChem CID 6862358) has the molecular formula C15H13N3O
and a molecular weight of 251.28 g/mol. Its IUPAC name is N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | Isonicotinic acid, cinnamylidenehydrazide |
| PubChem CID | 6862358 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]pyridine-4-carboxamide |
| SMILES | C1=CC=C(C=C1)/C=C/C=N/NC(=O)C2=CC=NC=C2 |
| InChI | InChI=1S/C15H13N3O/c19-15(14-8-11-16-12-9-14)18-17-10-4-7-13-5-2-1-3-6-13/h1-12H,(H,18,19)/b7-4+,17-10+ |
| InChIKey | IZMVXNJRIXIGGM-CUQLSPFUSA-N |
| XLogP | 2.20 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 326 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Isonicotinic acid, cinnamylidenehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Isonicotinic acid, cinnamylidenehydrazide?
The IUPAC name of Isonicotinic acid, cinnamylidenehydrazide (CID 6862358) is N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]pyridine-4-carboxamide.
What is the SMILES notation for Isonicotinic acid, cinnamylidenehydrazide?
The canonical SMILES for Isonicotinic acid, cinnamylidenehydrazide is C1=CC=C(C=C1)/C=C/C=N/NC(=O)C2=CC=NC=C2.
What is the InChIKey of Isonicotinic acid, cinnamylidenehydrazide?
The InChIKey is IZMVXNJRIXIGGM-CUQLSPFUSA-N. The full InChI is InChI=1S/C15H13N3O/c19-15(14-8-11-16-12-9-14)18-17-10-4-7-13-5-2-1-3-6-13/h1-12H,(H,18,19)/b7-4+,17-10+.
What are the key properties of Isonicotinic acid, cinnamylidenehydrazide?
Isonicotinic acid, cinnamylidenehydrazide has a molecular weight of 251.28 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Isonicotinic acid, cinnamylidenehydrazide is sourced from PubChem (CID 6862358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).