About 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane
4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane (PubChem CID 68623648) has the molecular formula C26H26O3P+
and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane |
| PubChem CID | 68623648 |
| Molecular Formula | C26H26O3P+ |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane |
| SMILES | C=CCC12CO[P+](C(c3ccccc3)(c3ccccc3)c3ccccc3)(OC1)OC2 |
| InChI | InChI=1S/C26H26O3P/c1-2-18-25-19-27-30(28-20-25,29-21-25)26(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h2-17H,1,18-21H2/q+1 |
| InChIKey | ULLCFHBFOZCZSM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane?
The IUPAC name of 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane (CID 68623648) is 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane.
What is the SMILES notation for 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane?
The canonical SMILES for 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane is C=CCC12CO[P+](C(c3ccccc3)(c3ccccc3)c3ccccc3)(OC1)OC2.
What is the InChIKey of 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane?
The InChIKey is ULLCFHBFOZCZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26O3P/c1-2-18-25-19-27-30(28-20-25,29-21-25)26(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h2-17H,1,18-21H2/q+1.
What are the key properties of 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane?
4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane has a molecular weight of 417.47 g/mol, XLogP of 6.38, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enyl-1-trityl-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane is sourced from PubChem (CID 68623648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).