C20H15BrN4O2S — CID 68623655
6-[4-[(5-bromothiophene-2-carbonyl)amino]phenyl]-N-methyl-1H-indazole-3-carboxamide (PubChem CID 68623655) has the molecular formula C20H15BrN4O2S and a molecular weight of 455.34 g/mol. Its IUPAC name is 6-[4-[(5-bromothiophene-2-carbonyl)amino]phenyl]-N-methyl-1H-indazole-3-carboxamide.
| Compound Name | 6-[4-[(5-bromothiophene-2-carbonyl)amino]phenyl]-N-methyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 68623655 |
| Molecular Formula | C20H15BrN4O2S |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 6-[4-[(5-bromothiophene-2-carbonyl)amino]phenyl]-N-methyl-1H-indazole-3-carboxamide |
| SMILES | CNC(=O)c1n[nH]c2cc(-c3ccc(NC(=O)c4ccc(Br)s4)cc3)ccc12 |
| InChI | InChI=1S/C20H15BrN4O2S/c1-22-20(27)18-14-7-4-12(10-15(14)24-25-18)11-2-5-13(6-3-11)23-19(26)16-8-9-17(21)28-16/h2-10H,1H3,(H,22,27)(H,23,26)(H,24,25) |
| InChIKey | QHUKQYYYWSJIHT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |