C26H31N5O3 — CID 68624740
6-[5-(4-methoxyphenoxy)pyrimidin-2-yl]-2-(3-pyrrolidin-1-ylpropoxy)-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 68624740) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 6-[5-(4-methoxyphenoxy)pyrimidin-2-yl]-2-(3-pyrrolidin-1-ylpropoxy)-7,8-dihydro-5H-1,6-naphthyridine.
| Compound Name | 6-[5-(4-methoxyphenoxy)pyrimidin-2-yl]-2-(3-pyrrolidin-1-ylpropoxy)-7,8-dihydro-5H-1,6-naphthyridine |
|---|---|
| PubChem CID | 68624740 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 6-[5-(4-methoxyphenoxy)pyrimidin-2-yl]-2-(3-pyrrolidin-1-ylpropoxy)-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | COc1ccc(Oc2cnc(N3CCc4nc(OCCCN5CCCC5)ccc4C3)nc2)cc1 |
| InChI | InChI=1S/C26H31N5O3/c1-32-21-6-8-22(9-7-21)34-23-17-27-26(28-18-23)31-15-11-24-20(19-31)5-10-25(29-24)33-16-4-14-30-12-2-3-13-30/h5-10,17-18H,2-4,11-16,19H2,1H3 |
| InChIKey | HZQHPPXCPLOUCN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|