About (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid
(2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 68624873) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| PubChem CID | 68624873 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | O=C(O)N1CC=CC[C@H]1CO |
| InChI | InChI=1S/C7H11NO3/c9-5-6-3-1-2-4-8(6)7(10)11/h1-2,6,9H,3-5H2,(H,10,11)/t6-/m0/s1 |
| InChIKey | IBHRTGLEKSHBLA-LURJTMIESA-N |
| XLogP | 0.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The IUPAC name of (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid (CID 68624873) is (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
What is the SMILES notation for (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The canonical SMILES for (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid is O=C(O)N1CC=CC[C@H]1CO.
What is the InChIKey of (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The InChIKey is IBHRTGLEKSHBLA-LURJTMIESA-N. The full InChI is InChI=1S/C7H11NO3/c9-5-6-3-1-2-4-8(6)7(10)11/h1-2,6,9H,3-5H2,(H,10,11)/t6-/m0/s1.
What are the key properties of (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid?
(2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid is sourced from PubChem (CID 68624873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).