About 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine
4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine (PubChem CID 686256) has the molecular formula C8H11ClN4O2
and a molecular weight of 230.65 g/mol. Its IUPAC name is 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine |
| PubChem CID | 686256 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine |
| SMILES | COc1nc(Cl)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C8H11ClN4O2/c1-14-8-11-6(9)10-7(12-8)13-2-4-15-5-3-13/h2-5H2,1H3 |
| InChIKey | QZVKLRQIMUKUBT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine?
The IUPAC name of 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine (CID 686256) is 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine.
What is the SMILES notation for 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine?
The canonical SMILES for 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine is COc1nc(Cl)nc(N2CCOCC2)n1.
What is the InChIKey of 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine?
The InChIKey is QZVKLRQIMUKUBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN4O2/c1-14-8-11-6(9)10-7(12-8)13-2-4-15-5-3-13/h2-5H2,1H3.
What are the key properties of 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine?
4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine has a molecular weight of 230.65 g/mol, XLogP of 0.37, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)morpholine is sourced from PubChem (CID 686256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).