About 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine
1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine (PubChem CID 68625676) has the molecular formula C11H20N2Si
and a molecular weight of 208.38 g/mol. Its IUPAC name is 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine.
Molecular Properties
| Compound Name | 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine |
| PubChem CID | 68625676 |
| Molecular Formula | C11H20N2Si |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine |
| SMILES | CCNC(N)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C11H20N2Si/c1-4-13-11(12)14(2,3)10-8-6-5-7-9-10/h5-9,11,13H,4,12H2,1-3H3 |
| InChIKey | FFSIKHUSYZMEPF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine?
The IUPAC name of 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine (CID 68625676) is 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine.
What is the SMILES notation for 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine?
The canonical SMILES for 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine is CCNC(N)[Si](C)(C)c1ccccc1.
What is the InChIKey of 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine?
The InChIKey is FFSIKHUSYZMEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2Si/c1-4-13-11(12)14(2,3)10-8-6-5-7-9-10/h5-9,11,13H,4,12H2,1-3H3.
What are the key properties of 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine?
1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine has a molecular weight of 208.38 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[dimethyl(phenyl)silyl]-N'-ethylmethanediamine is sourced from PubChem (CID 68625676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).