About N,1-dimethylcyclopropan-1-amine;hydrochloride
N,1-dimethylcyclopropan-1-amine;hydrochloride (PubChem CID 68625800) has the molecular formula C5H12ClN
and a molecular weight of 121.61 g/mol. Its IUPAC name is N,1-dimethylcyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N,1-dimethylcyclopropan-1-amine;hydrochloride |
| PubChem CID | 68625800 |
| Molecular Formula | C5H12ClN |
| Molecular Weight | 121.61 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | N,1-dimethylcyclopropan-1-amine;hydrochloride |
| SMILES | CNC1(C)CC1.Cl |
| InChI | InChI=1S/C5H11N.ClH/c1-5(6-2)3-4-5;/h6H,3-4H2,1-2H3;1H |
| InChIKey | UWMJTUHARUFWTC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.61 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,1-dimethylcyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethylcyclopropan-1-amine;hydrochloride?
The IUPAC name of N,1-dimethylcyclopropan-1-amine;hydrochloride (CID 68625800) is N,1-dimethylcyclopropan-1-amine;hydrochloride.
What is the SMILES notation for N,1-dimethylcyclopropan-1-amine;hydrochloride?
The canonical SMILES for N,1-dimethylcyclopropan-1-amine;hydrochloride is CNC1(C)CC1.Cl.
What is the InChIKey of N,1-dimethylcyclopropan-1-amine;hydrochloride?
The InChIKey is UWMJTUHARUFWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.ClH/c1-5(6-2)3-4-5;/h6H,3-4H2,1-2H3;1H.
What are the key properties of N,1-dimethylcyclopropan-1-amine;hydrochloride?
N,1-dimethylcyclopropan-1-amine;hydrochloride has a molecular weight of 121.61 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethylcyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 68625800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).