C34H47ClN4O5S — CID 68626172
8-[4,4-dimethyl-2-oxo-1-[(3S,4S)-4-phenylpyrrolidin-3-yl]pentyl]-1-ethyl-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 68626172) has the molecular formula C34H47ClN4O5S and a molecular weight of 659.29 g/mol. Its IUPAC name is 8-[4,4-dimethyl-2-oxo-1-[(3S,4S)-4-phenylpyrrolidin-3-yl]pentyl]-1-ethyl-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 8-[4,4-dimethyl-2-oxo-1-[(3S,4S)-4-phenylpyrrolidin-3-yl]pentyl]-1-ethyl-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 68626172 |
| Molecular Formula | C34H47ClN4O5S |
| Molecular Weight | 659.29 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | 8-[4,4-dimethyl-2-oxo-1-[(3S,4S)-4-phenylpyrrolidin-3-yl]pentyl]-1-ethyl-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | CCN1C(=O)N(Cc2ccc(S(C)(=O)=O)cc2)C(=O)C12CCN(C(C(=O)CC(C)(C)C)[C@@H]1CNC[C@@H]1c1ccccc1)CC2.Cl |
| InChI | InChI=1S/C34H46N4O5S.ClH/c1-6-38-32(41)37(23-24-12-14-26(15-13-24)44(5,42)43)31(40)34(38)16-18-36(19-17-34)30(29(39)20-33(2,3)4)28-22-35-21-27(28)25-10-8-7-9-11-25;/h7-15,27-28,30,35H,6,16-23H2,1-5H3;1H/t27-,28-,30?;/m1./s1 |
| InChIKey | GXEDTYAWZSXUBT-FOISKCQSSA-N |
| XLogP | 4.51 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|