C35H32F4N8O — CID 68626340
6-N-[7-(4-fluorophenyl)-1,6-naphthyridin-5-yl]-3-N-[7-[3-(trifluoromethoxy)phenyl]-1,6-naphthyridin-5-yl]hexane-1,3,4,6-tetramine (PubChem CID 68626340) has the molecular formula C35H32F4N8O and a molecular weight of 656.69 g/mol. Its IUPAC name is 6-N-[7-(4-fluorophenyl)-1,6-naphthyridin-5-yl]-3-N-[7-[3-(trifluoromethoxy)phenyl]-1,6-naphthyridin-5-yl]hexane-1,3,4,6-tetramine.
| Compound Name | 6-N-[7-(4-fluorophenyl)-1,6-naphthyridin-5-yl]-3-N-[7-[3-(trifluoromethoxy)phenyl]-1,6-naphthyridin-5-yl]hexane-1,3,4,6-tetramine |
|---|---|
| PubChem CID | 68626340 |
| Molecular Formula | C35H32F4N8O |
| Molecular Weight | 656.69 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 6-N-[7-(4-fluorophenyl)-1,6-naphthyridin-5-yl]-3-N-[7-[3-(trifluoromethoxy)phenyl]-1,6-naphthyridin-5-yl]hexane-1,3,4,6-tetramine |
| SMILES | NCCC(Nc1nc(-c2cccc(OC(F)(F)F)c2)cc2ncccc12)C(N)CCNc1nc(-c2ccc(F)cc2)cc2ncccc12 |
| InChI | InChI=1S/C35H32F4N8O/c36-23-10-8-21(9-11-23)29-19-31-25(6-2-15-42-31)33(46-29)44-17-13-27(41)28(12-14-40)45-34-26-7-3-16-43-32(26)20-30(47-34)22-4-1-5-24(18-22)48-35(37,38)39/h1-11,15-16,18-20,27-28H,12-14,17,40-41H2,(H,44,46)(H,45,47) |
| InChIKey | OYIGZBOHEPRCQP-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 136.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |