About 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid
1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid (PubChem CID 68626634) has the molecular formula C15H23NO4
and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid |
| PubChem CID | 68626634 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCC(C1CCC(=O)C(=O)C1)N1CCCC1C(=O)O |
| InChI | InChI=1S/C15H23NO4/c1-2-4-11(10-6-7-13(17)14(18)9-10)16-8-3-5-12(16)15(19)20/h10-12H,2-9H2,1H3,(H,19,20) |
| InChIKey | PVDCPBHGZHKRLT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid?
The IUPAC name of 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid (CID 68626634) is 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid?
The canonical SMILES for 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid is CCCC(C1CCC(=O)C(=O)C1)N1CCCC1C(=O)O.
What is the InChIKey of 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid?
The InChIKey is PVDCPBHGZHKRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4/c1-2-4-11(10-6-7-13(17)14(18)9-10)16-8-3-5-12(16)15(19)20/h10-12H,2-9H2,1H3,(H,19,20).
What are the key properties of 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid?
1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid has a molecular weight of 281.35 g/mol, XLogP of 1.64, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,4-dioxocyclohexyl)butyl]pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 68626634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).