About 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline
3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline (PubChem CID 68626792) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline.
Molecular Properties
| Compound Name | 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline |
| PubChem CID | 68626792 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline |
| SMILES | Cc1ccc(N)cc1CN1CCNC(C)(C)C1 |
| InChI | InChI=1S/C14H23N3/c1-11-4-5-13(15)8-12(11)9-17-7-6-16-14(2,3)10-17/h4-5,8,16H,6-7,9-10,15H2,1-3H3 |
| InChIKey | IGNSFHOJKMZXND-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline?
The IUPAC name of 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline (CID 68626792) is 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline.
What is the SMILES notation for 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline?
The canonical SMILES for 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline is Cc1ccc(N)cc1CN1CCNC(C)(C)C1.
What is the InChIKey of 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline?
The InChIKey is IGNSFHOJKMZXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3/c1-11-4-5-13(15)8-12(11)9-17-7-6-16-14(2,3)10-17/h4-5,8,16H,6-7,9-10,15H2,1-3H3.
What are the key properties of 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline?
3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline has a molecular weight of 233.36 g/mol, XLogP of 1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,3-dimethylpiperazin-1-yl)methyl]-4-methylaniline is sourced from PubChem (CID 68626792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).