C19H26BF5N2O2 — CID 68627188
2-[1,1-difluoro-2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 68627188) has the molecular formula C19H26BF5N2O2 and a molecular weight of 420.23 g/mol. Its IUPAC name is 2-[1,1-difluoro-2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-[1,1-difluoro-2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 68627188 |
| Molecular Formula | C19H26BF5N2O2 |
| Molecular Weight | 420.23 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[1,1-difluoro-2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2ccc(C(F)(F)CN3CCC(C(F)(F)F)CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C19H26BF5N2O2/c1-16(2)17(3,4)29-20(28-16)14-5-6-15(26-11-14)18(21,22)12-27-9-7-13(8-10-27)19(23,24)25/h5-6,11,13H,7-10,12H2,1-4H3 |
| InChIKey | QGBPDYXOWDNIFL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|