C46H46Cl2N6O2 — CID 68627831
3,6-bis[4-(4-chloro-9H-pyrido[2,3-b]indol-6-yl)phenoxy]-4-N,4-N-diethyl-1-N,1-N-dimethylhexane-1,4-diamine (PubChem CID 68627831) has the molecular formula C46H46Cl2N6O2 and a molecular weight of 785.82 g/mol. Its IUPAC name is 3,6-bis[4-(4-chloro-9H-pyrido[2,3-b]indol-6-yl)phenoxy]-4-N,4-N-diethyl-1-N,1-N-dimethylhexane-1,4-diamine.
| Compound Name | 3,6-bis[4-(4-chloro-9H-pyrido[2,3-b]indol-6-yl)phenoxy]-4-N,4-N-diethyl-1-N,1-N-dimethylhexane-1,4-diamine |
|---|---|
| PubChem CID | 68627831 |
| Molecular Formula | C46H46Cl2N6O2 |
| Molecular Weight | 785.82 g/mol |
| Exact Mass | 784.31 |
| IUPAC Name | 3,6-bis[4-(4-chloro-9H-pyrido[2,3-b]indol-6-yl)phenoxy]-4-N,4-N-diethyl-1-N,1-N-dimethylhexane-1,4-diamine |
| SMILES | CCN(CC)C(CCOc1ccc(-c2ccc3[nH]c4nccc(Cl)c4c3c2)cc1)C(CCN(C)C)Oc1ccc(-c2ccc3[nH]c4nccc(Cl)c4c3c2)cc1 |
| InChI | InChI=1S/C46H46Cl2N6O2/c1-5-54(6-2)41(22-26-55-33-13-7-29(8-14-33)31-11-17-39-35(27-31)43-37(47)19-23-49-45(43)51-39)42(21-25-53(3)4)56-34-15-9-30(10-16-34)32-12-18-40-36(28-32)44-38(48)20-24-50-46(44)52-40/h7-20,23-24,27-28,41-42H,5-6,21-22,25-26H2,1-4H3,(H,49,51)(H,50,52) |
| InChIKey | SFXYEQVJZAEVBG-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.82 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |