C19H29BO6 — CID 68628047
2-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3,3-dimethylbutanoic acid (PubChem CID 68628047) has the molecular formula C19H29BO6 and a molecular weight of 364.25 g/mol. Its IUPAC name is 2-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 68628047 |
| Molecular Formula | C19H29BO6 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 2-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-3,3-dimethylbutanoic acid |
| SMILES | COc1cc(OC(C(=O)O)C(C)(C)C)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H29BO6/c1-17(2,3)15(16(21)22)24-12-9-10-13(14(11-12)23-8)20-25-18(4,5)19(6,7)26-20/h9-11,15H,1-8H3,(H,21,22) |
| InChIKey | KDQMGDPNUFAZLJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|