About 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine
6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine (PubChem CID 68628196) has the molecular formula C18H16ClF2N3O2
and a molecular weight of 379.79 g/mol. Its IUPAC name is 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine.
Molecular Properties
| Compound Name | 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine |
| PubChem CID | 68628196 |
| Molecular Formula | C18H16ClF2N3O2 |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine |
| SMILES | COc1cc2c(Nc3cc(F)cc(F)c3)nncc2cc1OCCCCl |
| InChI | InChI=1S/C18H16ClF2N3O2/c1-25-16-9-15-11(5-17(16)26-4-2-3-19)10-22-24-18(15)23-14-7-12(20)6-13(21)8-14/h5-10H,2-4H2,1H3,(H,23,24) |
| InChIKey | CFJSHQKMTDXHKV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine?
The IUPAC name of 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine (CID 68628196) is 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine.
What is the SMILES notation for 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine?
The canonical SMILES for 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine is COc1cc2c(Nc3cc(F)cc(F)c3)nncc2cc1OCCCCl.
What is the InChIKey of 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine?
The InChIKey is CFJSHQKMTDXHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClF2N3O2/c1-25-16-9-15-11(5-17(16)26-4-2-3-19)10-22-24-18(15)23-14-7-12(20)6-13(21)8-14/h5-10H,2-4H2,1H3,(H,23,24).
What are the key properties of 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine?
6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine has a molecular weight of 379.79 g/mol, XLogP of 4.67, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chloropropoxy)-N-(3,5-difluorophenyl)-7-methoxyphthalazin-1-amine is sourced from PubChem (CID 68628196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).