About 1-(hexylamino)pyrrole-2,5-dione;hydrochloride
1-(hexylamino)pyrrole-2,5-dione;hydrochloride (PubChem CID 68628926) has the molecular formula C10H17ClN2O2
and a molecular weight of 232.71 g/mol. Its IUPAC name is 1-(hexylamino)pyrrole-2,5-dione;hydrochloride.
Molecular Properties
| Compound Name | 1-(hexylamino)pyrrole-2,5-dione;hydrochloride |
| PubChem CID | 68628926 |
| Molecular Formula | C10H17ClN2O2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-(hexylamino)pyrrole-2,5-dione;hydrochloride |
| SMILES | CCCCCCNN1C(=O)C=CC1=O.Cl |
| InChI | InChI=1S/C10H16N2O2.ClH/c1-2-3-4-5-8-11-12-9(13)6-7-10(12)14;/h6-7,11H,2-5,8H2,1H3;1H |
| InChIKey | BFWYXVLWYSXQJE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(hexylamino)pyrrole-2,5-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hexylamino)pyrrole-2,5-dione;hydrochloride?
The IUPAC name of 1-(hexylamino)pyrrole-2,5-dione;hydrochloride (CID 68628926) is 1-(hexylamino)pyrrole-2,5-dione;hydrochloride.
What is the SMILES notation for 1-(hexylamino)pyrrole-2,5-dione;hydrochloride?
The canonical SMILES for 1-(hexylamino)pyrrole-2,5-dione;hydrochloride is CCCCCCNN1C(=O)C=CC1=O.Cl.
What is the InChIKey of 1-(hexylamino)pyrrole-2,5-dione;hydrochloride?
The InChIKey is BFWYXVLWYSXQJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2.ClH/c1-2-3-4-5-8-11-12-9(13)6-7-10(12)14;/h6-7,11H,2-5,8H2,1H3;1H.
What are the key properties of 1-(hexylamino)pyrrole-2,5-dione;hydrochloride?
1-(hexylamino)pyrrole-2,5-dione;hydrochloride has a molecular weight of 232.71 g/mol, XLogP of 1.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hexylamino)pyrrole-2,5-dione;hydrochloride is sourced from PubChem (CID 68628926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).