C22H23FN8O — CID 68629309
2-[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]guanidine (PubChem CID 68629309) has the molecular formula C22H23FN8O and a molecular weight of 434.48 g/mol. Its IUPAC name is 2-[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]guanidine.
| Compound Name | 2-[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 68629309 |
| Molecular Formula | C22H23FN8O |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]guanidine |
| SMILES | COc1cccc(-c2cc(F)ccc2C2CC(=NN=C(N)N)c3c(C)nc(N)nc3C2)n1 |
| InChI | InChI=1S/C22H23FN8O/c1-11-20-17(29-22(26)27-11)8-12(9-18(20)30-31-21(24)25)14-7-6-13(23)10-15(14)16-4-3-5-19(28-16)32-2/h3-7,10,12H,8-9H2,1-2H3,(H4,24,25,31)(H2,26,27,29) |
| InChIKey | YMTCQVXRPXDWIK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 150.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|