C12H19NO3S — CID 68629436
2,2-dimethyl-4-(2-morpholin-4-ylethoxy)thiophen-3-one (PubChem CID 68629436) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-morpholin-4-ylethoxy)thiophen-3-one.
| Compound Name | 2,2-dimethyl-4-(2-morpholin-4-ylethoxy)thiophen-3-one |
|---|---|
| PubChem CID | 68629436 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2,2-dimethyl-4-(2-morpholin-4-ylethoxy)thiophen-3-one |
| SMILES | CC1(C)SC=C(OCCN2CCOCC2)C1=O |
| InChI | InChI=1S/C12H19NO3S/c1-12(2)11(14)10(9-17-12)16-8-5-13-3-6-15-7-4-13/h9H,3-8H2,1-2H3 |
| InChIKey | FINIKEWSDDFSII-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |