About N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine (PubChem CID 68629723) has the molecular formula C21H18N4
and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine.
Molecular Properties
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine |
| PubChem CID | 68629723 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine |
| SMILES | c1ccc2c(c1)CC[C@H]2Nc1ccc2cc(-c3ncc[nH]3)ccc2n1 |
| InChI | InChI=1S/C21H18N4/c1-2-4-17-14(3-1)5-9-19(17)25-20-10-7-15-13-16(6-8-18(15)24-20)21-22-11-12-23-21/h1-4,6-8,10-13,19H,5,9H2,(H,22,23)(H,24,25)/t19-/m1/s1 |
| InChIKey | SBXDGUDJHNPNQS-LJQANCHMSA-N |
| XLogP | 4.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine?
The IUPAC name of N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine (CID 68629723) is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine.
What is the SMILES notation for N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine?
The canonical SMILES for N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine is c1ccc2c(c1)CC[C@H]2Nc1ccc2cc(-c3ncc[nH]3)ccc2n1.
What is the InChIKey of N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine?
The InChIKey is SBXDGUDJHNPNQS-LJQANCHMSA-N. The full InChI is InChI=1S/C21H18N4/c1-2-4-17-14(3-1)5-9-19(17)25-20-10-7-15-13-16(6-8-18(15)24-20)21-22-11-12-23-21/h1-4,6-8,10-13,19H,5,9H2,(H,22,23)(H,24,25)/t19-/m1/s1.
What are the key properties of N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine?
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine has a molecular weight of 326.40 g/mol, XLogP of 4.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(1H-imidazol-2-yl)quinolin-2-amine is sourced from PubChem (CID 68629723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).