About 5-hydroxyhexyl 4-nitrobenzoate
5-hydroxyhexyl 4-nitrobenzoate (PubChem CID 68629782) has the molecular formula C13H17NO5
and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-hydroxyhexyl 4-nitrobenzoate.
Molecular Properties
| Compound Name | 5-hydroxyhexyl 4-nitrobenzoate |
| PubChem CID | 68629782 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 5-hydroxyhexyl 4-nitrobenzoate |
| SMILES | CC(O)CCCCOC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17NO5/c1-10(15)4-2-3-9-19-13(16)11-5-7-12(8-6-11)14(17)18/h5-8,10,15H,2-4,9H2,1H3 |
| InChIKey | MJTZCXQLLMAIKA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyhexyl 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyhexyl 4-nitrobenzoate?
The IUPAC name of 5-hydroxyhexyl 4-nitrobenzoate (CID 68629782) is 5-hydroxyhexyl 4-nitrobenzoate.
What is the SMILES notation for 5-hydroxyhexyl 4-nitrobenzoate?
The canonical SMILES for 5-hydroxyhexyl 4-nitrobenzoate is CC(O)CCCCOC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 5-hydroxyhexyl 4-nitrobenzoate?
The InChIKey is MJTZCXQLLMAIKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-10(15)4-2-3-9-19-13(16)11-5-7-12(8-6-11)14(17)18/h5-8,10,15H,2-4,9H2,1H3.
What are the key properties of 5-hydroxyhexyl 4-nitrobenzoate?
5-hydroxyhexyl 4-nitrobenzoate has a molecular weight of 267.28 g/mol, XLogP of 2.30, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyhexyl 4-nitrobenzoate is sourced from PubChem (CID 68629782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).