C23H32N2O2 — CID 68629934
(5,7-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl) propanoate (PubChem CID 68629934) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (5,7-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl) propanoate.
| Compound Name | (5,7-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl) propanoate |
|---|---|
| PubChem CID | 68629934 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | (5,7-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl) propanoate |
| SMILES | CCC(=O)OC1CCC2C1CCC1C3Cc4c(C)nn(C)c4C=C3CCC12 |
| InChI | InChI=1S/C23H32N2O2/c1-4-23(26)27-22-10-9-16-15-6-5-14-11-21-19(13(2)24-25(21)3)12-20(14)17(15)7-8-18(16)22/h11,15-18,20,22H,4-10,12H2,1-3H3 |
| InChIKey | AICSYIOUDJQQCJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |