C14H12F3NO2 — CID 68629948
4-(3,4,5-trifluorophenyl)-3,4,7,8-tetrahydro-1H-pyrido[2,1-c][1,4]oxazin-6-one (PubChem CID 68629948) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is 4-(3,4,5-trifluorophenyl)-3,4,7,8-tetrahydro-1H-pyrido[2,1-c][1,4]oxazin-6-one.
| Compound Name | 4-(3,4,5-trifluorophenyl)-3,4,7,8-tetrahydro-1H-pyrido[2,1-c][1,4]oxazin-6-one |
|---|---|
| PubChem CID | 68629948 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4-(3,4,5-trifluorophenyl)-3,4,7,8-tetrahydro-1H-pyrido[2,1-c][1,4]oxazin-6-one |
| SMILES | O=C1CCC=C2COCC(c3cc(F)c(F)c(F)c3)N12 |
| InChI | InChI=1S/C14H12F3NO2/c15-10-4-8(5-11(16)14(10)17)12-7-20-6-9-2-1-3-13(19)18(9)12/h2,4-5,12H,1,3,6-7H2 |
| InChIKey | ZGRBYQCOQWRZKW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|