C21H30O3 — CID 68630166
(8R,9S,10R,13S,14S)-3,17,17-trimethoxy-13-methyl-8,9,10,11,12,14,15,16-octahydro-7H-cyclopenta[a]phenanthrene (PubChem CID 68630166) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-3,17,17-trimethoxy-13-methyl-8,9,10,11,12,14,15,16-octahydro-7H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10R,13S,14S)-3,17,17-trimethoxy-13-methyl-8,9,10,11,12,14,15,16-octahydro-7H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 68630166 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (8R,9S,10R,13S,14S)-3,17,17-trimethoxy-13-methyl-8,9,10,11,12,14,15,16-octahydro-7H-cyclopenta[a]phenanthrene |
| SMILES | COC1=CC2=CC[C@@H]3[C@H](CC[C@@]4(C)[C@H]3CCC4(OC)OC)[C@H]2C=C1 |
| InChI | InChI=1S/C21H30O3/c1-20-11-9-17-16-8-6-15(22-2)13-14(16)5-7-18(17)19(20)10-12-21(20,23-3)24-4/h5-6,8,13,16-19H,7,9-12H2,1-4H3/t16-,17+,18+,19-,20-/m0/s1 |
| InChIKey | GQKVRYZMKISTFC-MDMHHNQBSA-N |
| XLogP | 4.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|