C21H25F3N4O2Si — CID 68631092
3-[5-[3-(trifluoromethoxy)phenyl]-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]aniline (PubChem CID 68631092) has the molecular formula C21H25F3N4O2Si and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-[5-[3-(trifluoromethoxy)phenyl]-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[5-[3-(trifluoromethoxy)phenyl]-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 68631092 |
| Molecular Formula | C21H25F3N4O2Si |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 3-[5-[3-(trifluoromethoxy)phenyl]-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]aniline |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cccc(N)c2)nnc1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H25F3N4O2Si/c1-31(2,3)11-10-29-14-28-19(15-6-4-8-17(25)12-15)26-27-20(28)16-7-5-9-18(13-16)30-21(22,23)24/h4-9,12-13H,10-11,14,25H2,1-3H3 |
| InChIKey | WDVIUIFYBAXTLW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|