About 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole
1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole (PubChem CID 68631177) has the molecular formula C21H16N4OS
and a molecular weight of 372.45 g/mol. Its IUPAC name is 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole.
Molecular Properties
| Compound Name | 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole |
| PubChem CID | 68631177 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole |
| SMILES | c1ccc2[nH]cnc2c1.c1ccc2ocnc2c1.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H6N2.C7H5NO.C7H5NS/c3*1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9);2*1-5H |
| InChIKey | OHXRAFGNMZEUIR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole?
The IUPAC name of 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole (CID 68631177) is 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole.
What is the SMILES notation for 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole?
The canonical SMILES for 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole is c1ccc2[nH]cnc2c1.c1ccc2ocnc2c1.c1ccc2scnc2c1.
What is the InChIKey of 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole?
The InChIKey is OHXRAFGNMZEUIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C7H5NO.C7H5NS/c3*1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9);2*1-5H.
What are the key properties of 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole?
1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole has a molecular weight of 372.45 g/mol, XLogP of 5.69, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;1,3-benzothiazole;1,3-benzoxazole is sourced from PubChem (CID 68631177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).