About [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate
[5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate (PubChem CID 68631443) has the molecular formula C15H15N5O3S
and a molecular weight of 345.38 g/mol. Its IUPAC name is [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate.
Molecular Properties
| Compound Name | [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate |
| PubChem CID | 68631443 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate |
| SMILES | C=CCNc1nc(-c2ccc(C)o2)c2c(N)c(OC(N)=O)sc2n1 |
| InChI | InChI=1S/C15H15N5O3S/c1-3-6-18-15-19-11(8-5-4-7(2)22-8)9-10(16)13(23-14(17)21)24-12(9)20-15/h3-5H,1,6,16H2,2H3,(H2,17,21)(H,18,19,20) |
| InChIKey | FMNVUHPQSBMIFX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate?
The IUPAC name of [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate (CID 68631443) is [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate.
What is the SMILES notation for [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate?
The canonical SMILES for [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate is C=CCNc1nc(-c2ccc(C)o2)c2c(N)c(OC(N)=O)sc2n1.
What is the InChIKey of [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate?
The InChIKey is FMNVUHPQSBMIFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O3S/c1-3-6-18-15-19-11(8-5-4-7(2)22-8)9-10(16)13(23-14(17)21)24-12(9)20-15/h3-5H,1,6,16H2,2H3,(H2,17,21)(H,18,19,20).
What are the key properties of [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate?
[5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate has a molecular weight of 345.38 g/mol, XLogP of 2.90, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-4-(5-methylfuran-2-yl)-2-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl] carbamate is sourced from PubChem (CID 68631443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).