C23H25F3N2O7 — CID 68631510
(2R,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[6-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol (PubChem CID 68631510) has the molecular formula C23H25F3N2O7 and a molecular weight of 498.45 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[6-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[6-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 68631510 |
| Molecular Formula | C23H25F3N2O7 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (2R,3S,4S,5S,6R)-6-(hydroxymethyl)-3-[[6-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]-2H-indazol-4-yl]oxy]oxane-2,3,4,5-tetrol |
| SMILES | Cc1cc(O[C@]2(O)[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]2O)c2c(CCc3ccc(C(F)(F)F)cc3)[nH]nc2c1 |
| InChI | InChI=1S/C23H25F3N2O7/c1-11-8-15-18(14(27-28-15)7-4-12-2-5-13(6-3-12)23(24,25)26)16(9-11)35-22(33)20(31)19(30)17(10-29)34-21(22)32/h2-3,5-6,8-9,17,19-21,29-33H,4,7,10H2,1H3,(H,27,28)/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | NVZPIBGLASWQGQ-VOFPXKNKSA-N |
| XLogP | 1.17 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|