C24H29BF3IN2O3 — CID 68631924
3-benzyl-1-(1-iodoethyl)-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 68631924) has the molecular formula C24H29BF3IN2O3 and a molecular weight of 588.22 g/mol. Its IUPAC name is 3-benzyl-1-(1-iodoethyl)-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 3-benzyl-1-(1-iodoethyl)-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 68631924 |
| Molecular Formula | C24H29BF3IN2O3 |
| Molecular Weight | 588.22 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 3-benzyl-1-(1-iodoethyl)-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CC(I)N(Cc1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H29BF3IN2O3/c1-16(29)31(21(32)30-14-17-9-7-6-8-10-17)15-18-13-19(24(26,27)28)11-12-20(18)25-33-22(2,3)23(4,5)34-25/h6-13,16H,14-15H2,1-5H3,(H,30,32) |
| InChIKey | LVBFXIIKWLIQAZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.22 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|