About spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride
spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride (PubChem CID 68631969) has the molecular formula C13H17ClN2
and a molecular weight of 236.75 g/mol. Its IUPAC name is spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride.
Molecular Properties
| Compound Name | spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride |
| PubChem CID | 68631969 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride |
| SMILES | C1=NCc2ccccc2C12CCNCC2.Cl |
| InChI | InChI=1S/C13H16N2.ClH/c1-2-4-12-11(3-1)9-15-10-13(12)5-7-14-8-6-13;/h1-4,10,14H,5-9H2;1H |
| InChIKey | KMPPBPZEQRHGFT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride?
The IUPAC name of spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride (CID 68631969) is spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride.
What is the SMILES notation for spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride?
The canonical SMILES for spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride is C1=NCc2ccccc2C12CCNCC2.Cl.
What is the InChIKey of spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride?
The InChIKey is KMPPBPZEQRHGFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2.ClH/c1-2-4-12-11(3-1)9-15-10-13(12)5-7-14-8-6-13;/h1-4,10,14H,5-9H2;1H.
What are the key properties of spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride?
spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride has a molecular weight of 236.75 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-isoquinoline-4,4'-piperidine];hydrochloride is sourced from PubChem (CID 68631969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).