C11H6N2O — CID 68632147
2,3-diazatricyclo[7.3.1.05,13]trideca-1(13),2,4,6,8,11-hexaen-10-one (PubChem CID 68632147) has the molecular formula C11H6N2O and a molecular weight of 182.18 g/mol. Its IUPAC name is 2,3-diazatricyclo[7.3.1.05,13]trideca-1(13),2,4,6,8,11-hexaen-10-one.
| Compound Name | 2,3-diazatricyclo[7.3.1.05,13]trideca-1(13),2,4,6,8,11-hexaen-10-one |
|---|---|
| PubChem CID | 68632147 |
| Molecular Formula | C11H6N2O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 2,3-diazatricyclo[7.3.1.05,13]trideca-1(13),2,4,6,8,11-hexaen-10-one |
| SMILES | O=C1C=Cc2nncc3cccc1c23 |
| InChI | InChI=1S/C11H6N2O/c14-10-5-4-9-11-7(6-12-13-9)2-1-3-8(10)11/h1-6H |
| InChIKey | JVILZGSRPAUVOL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |