About methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate
methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate (PubChem CID 68632217) has the molecular formula C22H23Cl2NO2
and a molecular weight of 404.34 g/mol. Its IUPAC name is methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate |
| PubChem CID | 68632217 |
| Molecular Formula | C22H23Cl2NO2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(C2CCCN2CCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H23Cl2NO2/c1-27-22(26)11-6-16-4-7-18(8-5-16)21-3-2-13-25(21)14-12-17-9-10-19(23)15-20(17)24/h4-11,15,21H,2-3,12-14H2,1H3/b11-6+ |
| InChIKey | ORFYEGJJMPGHIM-IZZDOVSWSA-N |
| XLogP | 5.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate?
The IUPAC name of methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate (CID 68632217) is methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate?
The canonical SMILES for methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate is COC(=O)/C=C/c1ccc(C2CCCN2CCc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate?
The InChIKey is ORFYEGJJMPGHIM-IZZDOVSWSA-N. The full InChI is InChI=1S/C22H23Cl2NO2/c1-27-22(26)11-6-16-4-7-18(8-5-16)21-3-2-13-25(21)14-12-17-9-10-19(23)15-20(17)24/h4-11,15,21H,2-3,12-14H2,1H3/b11-6+.
What are the key properties of methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate?
methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate has a molecular weight of 404.34 g/mol, XLogP of 5.56, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[4-[1-[2-(2,4-dichlorophenyl)ethyl]pyrrolidin-2-yl]phenyl]prop-2-enoate is sourced from PubChem (CID 68632217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).