C9H12N2 — CID 68633294
1,1-dimethyl-2,3-dihydropyrrolo[3,4-c]pyridine (PubChem CID 68633294) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1,1-dimethyl-2,3-dihydropyrrolo[3,4-c]pyridine.
| Compound Name | 1,1-dimethyl-2,3-dihydropyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 68633294 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1,1-dimethyl-2,3-dihydropyrrolo[3,4-c]pyridine |
| SMILES | CC1(C)NCc2cnccc21 |
| InChI | InChI=1S/C9H12N2/c1-9(2)8-3-4-10-5-7(8)6-11-9/h3-5,11H,6H2,1-2H3 |
| InChIKey | OQBDFPGVQOBFET-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |