About [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate
[5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate (PubChem CID 68633408) has the molecular formula C16H18N4O3S
and a molecular weight of 346.41 g/mol. Its IUPAC name is [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate.
Molecular Properties
| Compound Name | [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate |
| PubChem CID | 68633408 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate |
| SMILES | Cc1ccc(-c2nc(C(C)(C)C)nc3sc(OC(N)=O)c(N)c23)o1 |
| InChI | InChI=1S/C16H18N4O3S/c1-7-5-6-8(22-7)11-9-10(17)13(23-15(18)21)24-12(9)20-14(19-11)16(2,3)4/h5-6H,17H2,1-4H3,(H2,18,21) |
| InChIKey | CIMMODDZURDLKW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate?
The IUPAC name of [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate (CID 68633408) is [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate.
What is the SMILES notation for [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate?
The canonical SMILES for [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate is Cc1ccc(-c2nc(C(C)(C)C)nc3sc(OC(N)=O)c(N)c23)o1.
What is the InChIKey of [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate?
The InChIKey is CIMMODDZURDLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O3S/c1-7-5-6-8(22-7)11-9-10(17)13(23-15(18)21)24-12(9)20-14(19-11)16(2,3)4/h5-6H,17H2,1-4H3,(H2,18,21).
What are the key properties of [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate?
[5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate has a molecular weight of 346.41 g/mol, XLogP of 3.60, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-2-tert-butyl-4-(5-methylfuran-2-yl)thieno[2,3-d]pyrimidin-6-yl] carbamate is sourced from PubChem (CID 68633408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).