About 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea
1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea (PubChem CID 68633602) has the molecular formula C22H23FN4O
and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea |
| PubChem CID | 68633602 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc2nc(NC3CCc4cccc(F)c43)ccc2c1 |
| InChI | InChI=1S/C22H23FN4O/c1-13(2)24-22(28)25-16-8-10-18-15(12-16)7-11-20(26-18)27-19-9-6-14-4-3-5-17(23)21(14)19/h3-5,7-8,10-13,19H,6,9H2,1-2H3,(H,26,27)(H2,24,25,28) |
| InChIKey | HNNJSTCIGMBEFR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea?
The IUPAC name of 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea (CID 68633602) is 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea.
What is the SMILES notation for 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea?
The canonical SMILES for 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea is CC(C)NC(=O)Nc1ccc2nc(NC3CCc4cccc(F)c43)ccc2c1.
What is the InChIKey of 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea?
The InChIKey is HNNJSTCIGMBEFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23FN4O/c1-13(2)24-22(28)25-16-8-10-18-15(12-16)7-11-20(26-18)27-19-9-6-14-4-3-5-17(23)21(14)19/h3-5,7-8,10-13,19H,6,9H2,1-2H3,(H,26,27)(H2,24,25,28).
What are the key properties of 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea?
1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea has a molecular weight of 378.45 g/mol, XLogP of 5.00, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(7-fluoro-2,3-dihydro-1H-inden-1-yl)amino]quinolin-6-yl]-3-propan-2-ylurea is sourced from PubChem (CID 68633602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).