About 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine
2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine (PubChem CID 68634220) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine |
| PubChem CID | 68634220 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine |
| SMILES | On1cccc2cc(C3=CC=C3)nc1-2 |
| InChI | InChI=1S/C11H8N2O/c14-13-6-2-5-9-7-10(12-11(9)13)8-3-1-4-8/h1-7,14H |
| InChIKey | MNJNPWSBHUGECQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine?
The IUPAC name of 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine (CID 68634220) is 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine?
The canonical SMILES for 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine is On1cccc2cc(C3=CC=C3)nc1-2.
What is the InChIKey of 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine?
The InChIKey is MNJNPWSBHUGECQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c14-13-6-2-5-9-7-10(12-11(9)13)8-3-1-4-8/h1-7,14H.
What are the key properties of 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine?
2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine has a molecular weight of 184.20 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclobutadienyl)-7-hydroxypyrrolo[2,3-b]pyridine is sourced from PubChem (CID 68634220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).