C17H14N6 — CID 6863423
N-[(E)-(4-methylphenyl)methylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 6863423) has the molecular formula C17H14N6 and a molecular weight of 302.34 g/mol. Its IUPAC name is N-[(E)-(4-methylphenyl)methylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | N-[(E)-(4-methylphenyl)methylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 6863423 |
| Molecular Formula | C17H14N6 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(E)-(4-methylphenyl)methylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | Cc1ccc(/C=N/Nc2nn3cnnc3c3ccccc23)cc1 |
| InChI | InChI=1S/C17H14N6/c1-12-6-8-13(9-7-12)10-18-20-16-14-4-2-3-5-15(14)17-21-19-11-23(17)22-16/h2-11H,1H3,(H,20,22)/b18-10+ |
| InChIKey | ASHYORSIXNQQQC-VCHYOVAHSA-N |
| XLogP | 3.03 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|