About 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine
3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 68634455) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine |
| PubChem CID | 68634455 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | C1=NCC2=CC=NCC12 |
| InChI | InChI=1S/C7H8N2/c1-2-8-4-7-5-9-3-6(1)7/h1-2,5,7H,3-4H2 |
| InChIKey | VDJJBQDYGFFHOP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine?
The IUPAC name of 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine (CID 68634455) is 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine.
What is the SMILES notation for 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine?
The canonical SMILES for 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine is C1=NCC2=CC=NCC12.
What is the InChIKey of 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine?
The InChIKey is VDJJBQDYGFFHOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-2-8-4-7-5-9-3-6(1)7/h1-2,5,7H,3-4H2.
What are the key properties of 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine?
3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine has a molecular weight of 120.15 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4-dihydro-1H-pyrrolo[3,4-c]pyridine is sourced from PubChem (CID 68634455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).