C16H13F2N3O4S2 — CID 68634520
3-[3-fluoro-2-(2-fluoro-3-pyridinyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylthiophene-2-carboxylic acid (PubChem CID 68634520) has the molecular formula C16H13F2N3O4S2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-[3-fluoro-2-(2-fluoro-3-pyridinyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylthiophene-2-carboxylic acid.
| Compound Name | 3-[3-fluoro-2-(2-fluoro-3-pyridinyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68634520 |
| Molecular Formula | C16H13F2N3O4S2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 3-[3-fluoro-2-(2-fluoro-3-pyridinyl)-4-(methylaminomethyl)pyrrol-1-yl]sulfonylthiophene-2-carboxylic acid |
| SMILES | CNCc1cn(S(=O)(=O)c2ccsc2C(=O)O)c(-c2cccnc2F)c1F |
| InChI | InChI=1S/C16H13F2N3O4S2/c1-19-7-9-8-21(13(12(9)17)10-3-2-5-20-15(10)18)27(24,25)11-4-6-26-14(11)16(22)23/h2-6,8,19H,7H2,1H3,(H,22,23) |
| InChIKey | BMNZZVUPUGNMLB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|