About [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid
[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid (PubChem CID 68634628) has the molecular formula C9H11N3O5
and a molecular weight of 241.20 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid.
Molecular Properties
| Compound Name | [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid |
| PubChem CID | 68634628 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid |
| SMILES | O=C(O)NNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11N3O5/c13-6(10-11-9(16)17)2-1-5-12-7(14)3-4-8(12)15/h3-4,11H,1-2,5H2,(H,10,13)(H,16,17) |
| InChIKey | DOEYRALGZKVTHX-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid?
The IUPAC name of [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid (CID 68634628) is [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid.
What is the SMILES notation for [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid?
The canonical SMILES for [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid is O=C(O)NNC(=O)CCCN1C(=O)C=CC1=O.
What is the InChIKey of [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid?
The InChIKey is DOEYRALGZKVTHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O5/c13-6(10-11-9(16)17)2-1-5-12-7(14)3-4-8(12)15/h3-4,11H,1-2,5H2,(H,10,13)(H,16,17).
What are the key properties of [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid?
[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid has a molecular weight of 241.20 g/mol, XLogP of -1.01, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamic acid is sourced from PubChem (CID 68634628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).