C24H26N6O3 — CID 68634963
tert-butyl-[2-[3-[[4-[2-(3-hydroxyprop-1-ynyl)-4-pyridinyl]-1,3,5-triazin-2-yl]amino]phenyl]ethyl]carbamic acid (PubChem CID 68634963) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is tert-butyl-[2-[3-[[4-[2-(3-hydroxyprop-1-ynyl)-4-pyridinyl]-1,3,5-triazin-2-yl]amino]phenyl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-[3-[[4-[2-(3-hydroxyprop-1-ynyl)-4-pyridinyl]-1,3,5-triazin-2-yl]amino]phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 68634963 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | tert-butyl-[2-[3-[[4-[2-(3-hydroxyprop-1-ynyl)-4-pyridinyl]-1,3,5-triazin-2-yl]amino]phenyl]ethyl]carbamic acid |
| SMILES | CC(C)(C)N(CCc1cccc(Nc2ncnc(-c3ccnc(C#CCO)c3)n2)c1)C(=O)O |
| InChI | InChI=1S/C24H26N6O3/c1-24(2,3)30(23(32)33)12-10-17-6-4-7-20(14-17)28-22-27-16-26-21(29-22)18-9-11-25-19(15-18)8-5-13-31/h4,6-7,9,11,14-16,31H,10,12-13H2,1-3H3,(H,32,33)(H,26,27,28,29) |
| InChIKey | HAMXBQPKBNLYTG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|