C21H22F3N3O6S2 — CID 68635012
N-(1,1-dioxothiolan-3-yl)-4-(2-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 68635012) has the molecular formula C21H22F3N3O6S2 and a molecular weight of 533.55 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(2-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(2-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68635012 |
| Molecular Formula | C21H22F3N3O6S2 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(2-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)benzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cc2c(-c3ccc(S(=O)(=O)NC4CCS(=O)(=O)C4)cc3)ccnc2[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N3O4S2.C2HF3O2/c1-2-14-11-18-17(7-9-20-19(18)21-14)13-3-5-16(6-4-13)28(25,26)22-15-8-10-27(23,24)12-15;3-2(4,5)1(6)7/h3-7,9,11,15,22H,2,8,10,12H2,1H3,(H,20,21);(H,6,7) |
| InChIKey | SQHJHBOHSPLCEU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |