About 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine
1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 68635070) has the molecular formula C15H33N5
and a molecular weight of 283.46 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine |
| PubChem CID | 68635070 |
| Molecular Formula | C15H33N5 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | C1CN2CCN1CC2.CN(C)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C9H21N3.C6H12N2/c1-10(2)4-7-12-8-5-11(3)6-9-12;1-2-8-5-3-7(1)4-6-8/h4-9H2,1-3H3;1-6H2 |
| InChIKey | GBSBTKSYUJKVMM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine (CID 68635070) is 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine is C1CN2CCN1CC2.CN(C)CCN1CCN(C)CC1.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine?
The InChIKey is GBSBTKSYUJKVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3.C6H12N2/c1-10(2)4-7-12-8-5-11(3)6-9-12;1-2-8-5-3-7(1)4-6-8/h4-9H2,1-3H3;1-6H2.
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine?
1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine has a molecular weight of 283.46 g/mol, XLogP of -0.59, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;N,N-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine is sourced from PubChem (CID 68635070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).