About N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide
N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide (PubChem CID 68635384) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide |
| PubChem CID | 68635384 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1(N)C=CC=CC1 |
| InChI | InChI=1S/C8H12N2O/c1-7(11)10-8(9)5-3-2-4-6-8/h2-5H,6,9H2,1H3,(H,10,11) |
| InChIKey | KTPYHGKLTIXKDZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide?
The IUPAC name of N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide (CID 68635384) is N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide.
What is the SMILES notation for N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide?
The canonical SMILES for N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide is CC(=O)NC1(N)C=CC=CC1.
What is the InChIKey of N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide?
The InChIKey is KTPYHGKLTIXKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-7(11)10-8(9)5-3-2-4-6-8/h2-5H,6,9H2,1H3,(H,10,11).
What are the key properties of N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide?
N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide has a molecular weight of 152.20 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminocyclohexa-2,4-dien-1-yl)acetamide is sourced from PubChem (CID 68635384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).