About biphenylene;oxetane
biphenylene;oxetane (PubChem CID 68635942) has the molecular formula C18H20O2
and a molecular weight of 268.36 g/mol. Its IUPAC name is biphenylene;oxetane.
Molecular Properties
| Compound Name | biphenylene;oxetane |
| PubChem CID | 68635942 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | biphenylene;oxetane |
| SMILES | C1COC1.C1COC1.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.2C3H6O/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;2*1-2-4-3-1/h1-8H;2*1-3H2 |
| InChIKey | RHJUQYUJOVKTOP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze biphenylene;oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;oxetane?
The IUPAC name of biphenylene;oxetane (CID 68635942) is biphenylene;oxetane.
What is the SMILES notation for biphenylene;oxetane?
The canonical SMILES for biphenylene;oxetane is C1COC1.C1COC1.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;oxetane?
The InChIKey is RHJUQYUJOVKTOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.2C3H6O/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;2*1-2-4-3-1/h1-8H;2*1-3H2.
What are the key properties of biphenylene;oxetane?
biphenylene;oxetane has a molecular weight of 268.36 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;oxetane is sourced from PubChem (CID 68635942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).