C11H11N3O — CID 68635954
3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carboxamide (PubChem CID 68635954) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carboxamide.
| Compound Name | 3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carboxamide |
|---|---|
| PubChem CID | 68635954 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carboxamide |
| SMILES | NC(=O)c1cc2c3c(ccc2[nH]1)NCC3 |
| InChI | InChI=1S/C11H11N3O/c12-11(15)10-5-7-6-3-4-13-8(6)1-2-9(7)14-10/h1-2,5,13-14H,3-4H2,(H2,12,15) |
| InChIKey | OKQJRGMTUGTURO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |