About spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione
spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione (PubChem CID 686361) has the molecular formula C12H14N2S
and a molecular weight of 218.33 g/mol. Its IUPAC name is spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione.
Molecular Properties
| Compound Name | spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione |
| PubChem CID | 686361 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione |
| SMILES | S=C1NC2(CCCC2)Nc2ccccc21 |
| InChI | InChI=1S/C12H14N2S/c15-11-9-5-1-2-6-10(9)13-12(14-11)7-3-4-8-12/h1-2,5-6,13H,3-4,7-8H2,(H,14,15) |
| InChIKey | CVKBGNGVPMPNQU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione?
The IUPAC name of spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione (CID 686361) is spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione.
What is the SMILES notation for spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione?
The canonical SMILES for spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione is S=C1NC2(CCCC2)Nc2ccccc21.
What is the InChIKey of spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione?
The InChIKey is CVKBGNGVPMPNQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c15-11-9-5-1-2-6-10(9)13-12(14-11)7-3-4-8-12/h1-2,5-6,13H,3-4,7-8H2,(H,14,15).
What are the key properties of spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione?
spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione has a molecular weight of 218.33 g/mol, XLogP of 2.65, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dihydroquinazoline-2,1'-cyclopentane]-4-thione is sourced from PubChem (CID 686361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).