C32H26F3N5O7 — CID 68636202
2-(4-nitrophenyl)ethyl 6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 68636202) has the molecular formula C32H26F3N5O7 and a molecular weight of 649.58 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl 6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(4-nitrophenyl)ethyl 6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68636202 |
| Molecular Formula | C32H26F3N5O7 |
| Molecular Weight | 649.58 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl 6-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(OCCc1ccc([N+](=O)[O-])cc1)c1cc2c3c(ccc2[nH]1)N(C(=O)c1cc2c4c(ccc2[nH]1)NCC4)CC3 |
| InChI | InChI=1S/C30H25N5O5.C2HF3O2/c36-29(26-15-21-19-9-12-31-23(19)5-6-24(21)32-26)34-13-10-20-22-16-27(33-25(22)7-8-28(20)34)30(37)40-14-11-17-1-3-18(4-2-17)35(38)39;3-2(4,5)1(6)7/h1-8,15-16,31-33H,9-14H2;(H,6,7) |
| InChIKey | MFYKHYXHSJJBIU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 170.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|